C22H19F2NO4S — CID 68691946
3-[3-[2-[(2,4-difluorophenyl)sulfonylamino]phenyl]propyl]benzoic acid (PubChem CID 68691946) has the molecular formula C22H19F2NO4S and a molecular weight of 431.46 g/mol. Its IUPAC name is 3-[3-[2-[(2,4-difluorophenyl)sulfonylamino]phenyl]propyl]benzoic acid.
| Compound Name | 3-[3-[2-[(2,4-difluorophenyl)sulfonylamino]phenyl]propyl]benzoic acid |
|---|---|
| PubChem CID | 68691946 |
| Molecular Formula | C22H19F2NO4S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-[3-[2-[(2,4-difluorophenyl)sulfonylamino]phenyl]propyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCCc2ccccc2NS(=O)(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C22H19F2NO4S/c23-18-11-12-21(19(24)14-18)30(28,29)25-20-10-2-1-7-16(20)8-3-5-15-6-4-9-17(13-15)22(26)27/h1-2,4,6-7,9-14,25H,3,5,8H2,(H,26,27) |
| InChIKey | VTCOKYAOQWYQCT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |