C42H35F3N2O12S2 — CID 158940968
4-[2-[2-[(2,4-difluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;4-[2-[2-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid (PubChem CID 158940968) has the molecular formula C42H35F3N2O12S2 and a molecular weight of 880.87 g/mol. Its IUPAC name is 4-[2-[2-[(2,4-difluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;4-[2-[2-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(2,4-difluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;4-[2-[2-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 158940968 |
| Molecular Formula | C42H35F3N2O12S2 |
| Molecular Weight | 880.87 g/mol |
| Exact Mass | 880.16 |
| IUPAC Name | 4-[2-[2-[(2,4-difluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;4-[2-[2-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOc2ccccc2NS(=O)(=O)c2ccc(F)cc2F)cc1.O=C(O)c1ccc(OCCOc2ccccc2NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H17F2NO6S.C21H18FNO6S/c22-15-7-10-20(17(23)13-15)31(27,28)24-18-3-1-2-4-19(18)30-12-11-29-16-8-5-14(6-9-16)21(25)26;22-17-5-1-4-8-20(17)30(26,27)23-18-6-2-3-7-19(18)29-14-13-28-16-11-9-15(10-12-16)21(24)25/h1-10,13,24H,11-12H2,(H,25,26);1-12,23H,13-14H2,(H,24,25) |
| InChIKey | JKFXQTZIHPDTHS-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 203.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|