C21H18ClNO6S — CID 68690715
4-[2-[2-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid (PubChem CID 68690715) has the molecular formula C21H18ClNO6S and a molecular weight of 447.90 g/mol. Its IUPAC name is 4-[2-[2-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68690715 |
| Molecular Formula | C21H18ClNO6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 4-[2-[2-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOc2ccccc2NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClNO6S/c22-16-7-11-18(12-8-16)30(26,27)23-19-3-1-2-4-20(19)29-14-13-28-17-9-5-15(6-10-17)21(24)25/h1-12,23H,13-14H2,(H,24,25) |
| InChIKey | CJUMSYCIJISTDI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|