C22H20ClNO6S — CID 68687829
2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid (PubChem CID 68687829) has the molecular formula C22H20ClNO6S and a molecular weight of 461.92 g/mol. Its IUPAC name is 2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 68687829 |
| Molecular Formula | C22H20ClNO6S |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1OCCOc1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClNO6S/c23-17-5-11-20(12-6-17)31(27,28)24-18-7-9-19(10-8-18)29-13-14-30-21-4-2-1-3-16(21)15-22(25)26/h1-12,24H,13-15H2,(H,25,26) |
| InChIKey | PSBQNYFTXIPTAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|