C46H42ClN3O12S2 — CID 90904973
[2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetyl] 2-[2-[2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetate (PubChem CID 90904973) has the molecular formula C46H42ClN3O12S2 and a molecular weight of 928.44 g/mol. Its IUPAC name is [2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetyl] 2-[2-[2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetate.
| Compound Name | [2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetyl] 2-[2-[2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 90904973 |
| Molecular Formula | C46H42ClN3O12S2 |
| Molecular Weight | 928.44 g/mol |
| Exact Mass | 927.19 |
| IUPAC Name | [2-[2-[2-[4-[(4-chlorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetyl] 2-[2-[2-[4-[(4-acetamidophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(OCCOc3ccccc3CC(=O)OC(=O)Cc3ccccc3OCCOc3ccc(NS(=O)(=O)c4ccc(Cl)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H42ClN3O12S2/c1-32(51)48-36-16-24-42(25-17-36)64(56,57)50-38-14-20-40(21-15-38)59-27-29-61-44-9-5-3-7-34(44)31-46(53)62-45(52)30-33-6-2-4-8-43(33)60-28-26-58-39-18-12-37(13-19-39)49-63(54,55)41-22-10-35(47)11-23-41/h2-25,49-50H,26-31H2,1H3,(H,48,51) |
| InChIKey | YUXXKRUXYPLCQV-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 201.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.44 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|