C25H27NO6S — CID 68689364
2-[2-[2-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid (PubChem CID 68689364) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[2-[2-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[2-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 68689364 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-[2-[2-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(OCCOc3ccccc3CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H27NO6S/c1-18(2)19-7-13-23(14-8-19)33(29,30)26-21-9-11-22(12-10-21)31-15-16-32-24-6-4-3-5-20(24)17-25(27)28/h3-14,18,26H,15-17H2,1-2H3,(H,27,28) |
| InChIKey | LDOAQBSULOJXEY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|