C28H25NO6S — CID 11540637
2-[2-[2-[4-[(4-phenylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid (PubChem CID 11540637) has the molecular formula C28H25NO6S and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[2-[2-[4-[(4-phenylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[2-[4-[(4-phenylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 11540637 |
| Molecular Formula | C28H25NO6S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 2-[2-[2-[4-[(4-phenylphenyl)sulfonylamino]phenoxy]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1OCCOc1ccc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H25NO6S/c30-28(31)20-23-8-4-5-9-27(23)35-19-18-34-25-14-12-24(13-15-25)29-36(32,33)26-16-10-22(11-17-26)21-6-2-1-3-7-21/h1-17,29H,18-20H2,(H,30,31) |
| InChIKey | WVDVEGFOLVWBIK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|