C23H22FNO6S — CID 68690108
3-[2-[2-[4-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid (PubChem CID 68690108) has the molecular formula C23H22FNO6S and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[2-[2-[4-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[2-[4-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68690108 |
| Molecular Formula | C23H22FNO6S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 3-[2-[2-[4-[(2-fluorophenyl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1OCCOc1ccc(NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C23H22FNO6S/c24-20-6-2-4-8-22(20)32(28,29)25-18-10-12-19(13-11-18)30-15-16-31-21-7-3-1-5-17(21)9-14-23(26)27/h1-8,10-13,25H,9,14-16H2,(H,26,27) |
| InChIKey | XZKPOJKOPMGEMV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|