C23H25N3O7S2 — CID 87541290
3-[2-[2-[4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid (PubChem CID 87541290) has the molecular formula C23H25N3O7S2 and a molecular weight of 519.60 g/mol. Its IUPAC name is 3-[2-[2-[4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[2-[4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 87541290 |
| Molecular Formula | C23H25N3O7S2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 3-[2-[2-[4-[(2-acetamido-4-methyl-1,3-thiazol-5-yl)sulfonylamino]phenoxy]ethoxy]phenyl]propanoic acid |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)Nc2ccc(OCCOc3ccccc3CCC(=O)O)cc2)s1 |
| InChI | InChI=1S/C23H25N3O7S2/c1-15-22(34-23(24-15)25-16(2)27)35(30,31)26-18-8-10-19(11-9-18)32-13-14-33-20-6-4-3-5-17(20)7-12-21(28)29/h3-6,8-11,26H,7,12-14H2,1-2H3,(H,28,29)(H,24,25,27) |
| InChIKey | AVAHHJYBSVYFPK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|