C26H23NO6S — CID 11655897
2-[2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]phenyl]acetic acid (PubChem CID 11655897) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-[2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 11655897 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 2-[2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1OCCOc1ccc(NS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H23NO6S/c28-26(29)18-21-7-3-4-8-25(21)33-16-15-32-23-12-10-22(11-13-23)27-34(30,31)24-14-9-19-5-1-2-6-20(19)17-24/h1-14,17,27H,15-16,18H2,(H,28,29) |
| InChIKey | WTWPDLKKLJSPCJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|