C50H48N2O13S2 — CID 158251988
2-[2-[4-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]benzoic acid (PubChem CID 158251988) has the molecular formula C50H48N2O13S2 and a molecular weight of 949.07 g/mol. Its IUPAC name is 2-[2-[4-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]benzoic acid.
| Compound Name | 2-[2-[4-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 158251988 |
| Molecular Formula | C50H48N2O13S2 |
| Molecular Weight | 949.07 g/mol |
| Exact Mass | 948.26 |
| IUPAC Name | 2-[2-[4-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid;2-[2-[4-(naphthalen-2-ylsulfonylamino)phenoxy]ethoxy]benzoic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)Nc2ccc(OCCOc3ccccc3C(=O)O)cc2)c(C)c1C.O=C(O)c1ccccc1OCCOc1ccc(NS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C25H27NO7S.C25H21NO6S/c1-16-15-23(31-4)17(2)18(3)24(16)34(29,30)26-19-9-11-20(12-10-19)32-13-14-33-22-8-6-5-7-21(22)25(27)28;27-25(28)23-7-3-4-8-24(23)32-16-15-31-21-12-10-20(11-13-21)26-33(29,30)22-14-9-18-5-1-2-6-19(18)17-22/h5-12,15,26H,13-14H2,1-4H3,(H,27,28);1-14,17,26H,15-16H2,(H,27,28) |
| InChIKey | GGVDGWGCYPXFKM-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 213.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.07 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|