C24H19NO4S — CID 58937102
2-methyl-5-[(4-naphthalen-2-ylphenyl)sulfamoyl]benzoic acid (PubChem CID 58937102) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-methyl-5-[(4-naphthalen-2-ylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2-methyl-5-[(4-naphthalen-2-ylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 58937102 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-methyl-5-[(4-naphthalen-2-ylphenyl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccc4ccccc4c3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C24H19NO4S/c1-16-6-13-22(15-23(16)24(26)27)30(28,29)25-21-11-9-18(10-12-21)20-8-7-17-4-2-3-5-19(17)14-20/h2-15,25H,1H3,(H,26,27) |
| InChIKey | ODGPQPCHBXUSSC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |