C21H17F2NO5S — CID 58937182
5-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 58937182) has the molecular formula C21H17F2NO5S and a molecular weight of 433.43 g/mol. Its IUPAC name is 5-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 58937182 |
| Molecular Formula | C21H17F2NO5S |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 5-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(OCc3cc(F)cc(F)c3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C21H17F2NO5S/c1-13-2-7-19(11-20(13)21(25)26)30(27,28)24-17-3-5-18(6-4-17)29-12-14-8-15(22)10-16(23)9-14/h2-11,24H,12H2,1H3,(H,25,26) |
| InChIKey | FORHHSVYEBTVTO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |