C24H26N4O5S — CID 130280736
5-[[4-[(Z)-3-(benzylamino)-2-hydrazinylprop-2-enoxy]phenyl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 130280736) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 5-[[4-[(Z)-3-(benzylamino)-2-hydrazinylprop-2-enoxy]phenyl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[[4-[(Z)-3-(benzylamino)-2-hydrazinylprop-2-enoxy]phenyl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 130280736 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 5-[[4-[(Z)-3-(benzylamino)-2-hydrazinylprop-2-enoxy]phenyl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(OC/C(=C/NCc3ccccc3)NN)cc2)cc1C(=O)O |
| InChI | InChI=1S/C24H26N4O5S/c1-17-7-12-22(13-23(17)24(29)30)34(31,32)28-19-8-10-21(11-9-19)33-16-20(27-25)15-26-14-18-5-3-2-4-6-18/h2-13,15,26-28H,14,16,25H2,1H3,(H,29,30)/b20-15- |
| InChIKey | VEABUNVCILCHAA-HKWRFOASSA-N |
| XLogP | 2.97 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|