C24H25N3O6S — CID 55350821
N-(4-methoxyphenyl)-4-methyl-3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 55350821) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-methyl-3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-4-methyl-3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55350821 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-(4-methoxyphenyl)-4-methyl-3-[[[2-(3-methylphenoxy)acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)NNC(=O)COc3cccc(C)c3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O6S/c1-16-5-4-6-20(13-16)33-15-23(28)25-26-24(29)22-14-21(12-7-17(22)2)34(30,31)27-18-8-10-19(32-3)11-9-18/h4-14,27H,15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | KXYIAKMYBBCVCN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|