C23H24N2O6S2 — CID 55844976
N-[2-(benzenesulfonyl)ethyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide (PubChem CID 55844976) has the molecular formula C23H24N2O6S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[2-(benzenesulfonyl)ethyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide.
| Compound Name | N-[2-(benzenesulfonyl)ethyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55844976 |
| Molecular Formula | C23H24N2O6S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[2-(benzenesulfonyl)ethyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)NCCS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O6S2/c1-17-8-13-21(33(29,30)25-18-9-11-19(31-2)12-10-18)16-22(17)23(26)24-14-15-32(27,28)20-6-4-3-5-7-20/h3-13,16,25H,14-15H2,1-2H3,(H,24,26) |
| InChIKey | JFSBTYYFOUHSTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |