C26H31N3O4S — CID 55455309
N-[3-[benzyl(methyl)amino]propyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide (PubChem CID 55455309) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55455309 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)NCCCN(C)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H31N3O4S/c1-20-10-15-24(34(31,32)28-22-11-13-23(33-3)14-12-22)18-25(20)26(30)27-16-7-17-29(2)19-21-8-5-4-6-9-21/h4-6,8-15,18,28H,7,16-17,19H2,1-3H3,(H,27,30) |
| InChIKey | REGPOKSNJPZRNW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|