C22H18F3NO5S2 — CID 58937146
2-methyl-5-[[4-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid (PubChem CID 58937146) has the molecular formula C22H18F3NO5S2 and a molecular weight of 497.52 g/mol. Its IUPAC name is 2-methyl-5-[[4-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid.
| Compound Name | 2-methyl-5-[[4-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 58937146 |
| Molecular Formula | C22H18F3NO5S2 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-methyl-5-[[4-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SCc3ccc(OC(F)(F)F)cc3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C22H18F3NO5S2/c1-14-2-11-19(12-20(14)21(27)28)33(29,30)26-16-5-9-18(10-6-16)32-13-15-3-7-17(8-4-15)31-22(23,24)25/h2-12,26H,13H2,1H3,(H,27,28) |
| InChIKey | XSKWMDMXYRDYRB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |