C21H16F3NO4S2 — CID 58937165
3-[[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid (PubChem CID 58937165) has the molecular formula C21H16F3NO4S2 and a molecular weight of 467.49 g/mol. Its IUPAC name is 3-[[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 58937165 |
| Molecular Formula | C21H16F3NO4S2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-[[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)Nc2ccc(SCc3ccc(C(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C21H16F3NO4S2/c22-21(23,24)16-6-4-14(5-7-16)13-30-18-10-8-17(9-11-18)25-31(28,29)19-3-1-2-15(12-19)20(26)27/h1-12,25H,13H2,(H,26,27) |
| InChIKey | RHKLLHQCCCMGGI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |