C20H17FN2O4S2 — CID 71170716
5-[[6-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 71170716) has the molecular formula C20H17FN2O4S2 and a molecular weight of 432.50 g/mol. Its IUPAC name is 5-[[6-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[[6-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 71170716 |
| Molecular Formula | C20H17FN2O4S2 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 5-[[6-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SCc3ccc(F)cc3)nc2)cc1C(=O)O |
| InChI | InChI=1S/C20H17FN2O4S2/c1-13-2-8-17(10-18(13)20(24)25)29(26,27)23-16-7-9-19(22-11-16)28-12-14-3-5-15(21)6-4-14/h2-11,23H,12H2,1H3,(H,24,25) |
| InChIKey | SQMGKQASGPTQAK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |