C19H14ClFN2O4S — CID 71170487
5-[[6-(3-chloro-4-fluorophenyl)-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 71170487) has the molecular formula C19H14ClFN2O4S and a molecular weight of 420.85 g/mol. Its IUPAC name is 5-[[6-(3-chloro-4-fluorophenyl)-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[[6-(3-chloro-4-fluorophenyl)-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 71170487 |
| Molecular Formula | C19H14ClFN2O4S |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 5-[[6-(3-chloro-4-fluorophenyl)-3-pyridinyl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccc(F)c(Cl)c3)nc2)cc1C(=O)O |
| InChI | InChI=1S/C19H14ClFN2O4S/c1-11-2-5-14(9-15(11)19(24)25)28(26,27)23-13-4-7-18(22-10-13)12-3-6-17(21)16(20)8-12/h2-10,23H,1H3,(H,24,25) |
| InChIKey | UVBNETZUIZAECQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |