C22H21NO6S — CID 68692437
4-[2-[2-[(3-methylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid (PubChem CID 68692437) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-[2-[2-[(3-methylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(3-methylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68692437 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 4-[2-[2-[(3-methylphenyl)sulfonylamino]phenoxy]ethoxy]benzoic acid |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccccc2OCCOc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H21NO6S/c1-16-5-4-6-19(15-16)30(26,27)23-20-7-2-3-8-21(20)29-14-13-28-18-11-9-17(10-12-18)22(24)25/h2-12,15,23H,13-14H2,1H3,(H,24,25) |
| InChIKey | VQPBFZUQVQVUCM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|