C22H18FNO5 — CID 68692642
4-[2-[2-[(2-fluorobenzoyl)amino]phenoxy]ethoxy]benzoic acid (PubChem CID 68692642) has the molecular formula C22H18FNO5 and a molecular weight of 395.39 g/mol. Its IUPAC name is 4-[2-[2-[(2-fluorobenzoyl)amino]phenoxy]ethoxy]benzoic acid.
| Compound Name | 4-[2-[2-[(2-fluorobenzoyl)amino]phenoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 68692642 |
| Molecular Formula | C22H18FNO5 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-[2-[2-[(2-fluorobenzoyl)amino]phenoxy]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOc2ccccc2NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H18FNO5/c23-18-6-2-1-5-17(18)21(25)24-19-7-3-4-8-20(19)29-14-13-28-16-11-9-15(10-12-16)22(26)27/h1-12H,13-14H2,(H,24,25)(H,26,27) |
| InChIKey | GZDZCBWKUIETNM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|