C17H16FNO2 — CID 17113262
2-fluoro-N-[2-(2-methylprop-2-enoxy)phenyl]benzamide (PubChem CID 17113262) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-methylprop-2-enoxy)phenyl]benzamide.
| Compound Name | 2-fluoro-N-[2-(2-methylprop-2-enoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17113262 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-fluoro-N-[2-(2-methylprop-2-enoxy)phenyl]benzamide |
| SMILES | C=C(C)COc1ccccc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H16FNO2/c1-12(2)11-21-16-10-6-5-9-15(16)19-17(20)13-7-3-4-8-14(13)18/h3-10H,1,11H2,2H3,(H,19,20) |
| InChIKey | KTAHASXVCJFNNJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|