C17H21N3O2 — CID 131895828
1-ethyl-3-methyl-N-[2-(2-methylprop-2-enoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 131895828) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[2-(2-methylprop-2-enoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-3-methyl-N-[2-(2-methylprop-2-enoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 131895828 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-ethyl-3-methyl-N-[2-(2-methylprop-2-enoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | C=C(C)COc1ccccc1NC(=O)c1cn(CC)nc1C |
| InChI | InChI=1S/C17H21N3O2/c1-5-20-10-14(13(4)19-20)17(21)18-15-8-6-7-9-16(15)22-11-12(2)3/h6-10H,2,5,11H2,1,3-4H3,(H,18,21) |
| InChIKey | BLBRAISVEHVNGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|