C7H12N4O — CID 46318394
1-ethyl-3-methylpyrazole-4-carbohydrazide (PubChem CID 46318394) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-ethyl-3-methylpyrazole-4-carbohydrazide.
| Compound Name | 1-ethyl-3-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46318394 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1-ethyl-3-methylpyrazole-4-carbohydrazide |
| SMILES | CCn1cc(C(=O)NN)c(C)n1 |
| InChI | InChI=1S/C7H12N4O/c1-3-11-4-6(5(2)10-11)7(12)9-8/h4H,3,8H2,1-2H3,(H,9,12) |
| InChIKey | XVABQBAMZSUCNI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|