C7H12N2 — CID 23556587
1-ethyl-3,4-dimethylpyrazole (PubChem CID 23556587) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-ethyl-3,4-dimethylpyrazole.
| Compound Name | 1-ethyl-3,4-dimethylpyrazole |
|---|---|
| PubChem CID | 23556587 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-ethyl-3,4-dimethylpyrazole |
| SMILES | CCn1cc(C)c(C)n1 |
| InChI | InChI=1S/C7H12N2/c1-4-9-5-6(2)7(3)8-9/h5H,4H2,1-3H3 |
| InChIKey | QYVRRKWAJJONJU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |