C23H22N2O2 — CID 17130408
N-(4-anilinophenyl)-2-(2-methylprop-2-enoxy)benzamide (PubChem CID 17130408) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-(4-anilinophenyl)-2-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 17130408 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-(4-anilinophenyl)-2-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O2/c1-17(2)16-27-22-11-7-6-10-21(22)23(26)25-20-14-12-19(13-15-20)24-18-8-4-3-5-9-18/h3-15,24H,1,16H2,2H3,(H,25,26) |
| InChIKey | HTMCBTIKVUHTID-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|