C18H19NO2 — CID 17130400
N-(3-methylphenyl)-2-(2-methylprop-2-enoxy)benzamide (PubChem CID 17130400) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-(3-methylphenyl)-2-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 17130400 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(3-methylphenyl)-2-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1ccccc1C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C18H19NO2/c1-13(2)12-21-17-10-5-4-9-16(17)18(20)19-15-8-6-7-14(3)11-15/h4-11H,1,12H2,2-3H3,(H,19,20) |
| InChIKey | JEFZXVVBSDJLGI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|