C11H16N2O3S3 — CID 103787685
N-[(1,1-dioxothiolan-2-yl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 103787685) has the molecular formula C11H16N2O3S3 and a molecular weight of 320.46 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 103787685 |
| Molecular Formula | C11H16N2O3S3 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C11H16N2O3S3/c1-7-9(18-11(17)13-7)5-10(14)12-6-8-3-2-4-19(8,15)16/h8H,2-6H2,1H3,(H,12,14)(H,13,17) |
| InChIKey | XYLCWSUNXHMFKB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|