C12H18N2OS2 — CID 107033495
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-prop-2-enyl-N-propylacetamide (PubChem CID 107033495) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-prop-2-enyl-N-propylacetamide.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-prop-2-enyl-N-propylacetamide |
|---|---|
| PubChem CID | 107033495 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-prop-2-enyl-N-propylacetamide |
| SMILES | C=CCN(CCC)C(=O)Cc1sc(=S)[nH]c1C |
| InChI | InChI=1S/C12H18N2OS2/c1-4-6-14(7-5-2)11(15)8-10-9(3)13-12(16)17-10/h4H,1,5-8H2,2-3H3,(H,13,16) |
| InChIKey | MUELMMWMGPBNPJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|