C14H16BrNO — CID 104851837
3-bromo-5-methyl-N,N-bis(prop-2-enyl)benzamide (PubChem CID 104851837) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 3-bromo-5-methyl-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 3-bromo-5-methyl-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 104851837 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-bromo-5-methyl-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C14H16BrNO/c1-4-6-16(7-5-2)14(17)12-8-11(3)9-13(15)10-12/h4-5,8-10H,1-2,6-7H2,3H3 |
| InChIKey | BHKVDKUUWKGGIX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|