C16H20BrNO3 — CID 94143951
3-bromo-4-ethoxy-5-methoxy-N,N-bis(prop-2-enyl)benzamide (PubChem CID 94143951) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-5-methoxy-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 3-bromo-4-ethoxy-5-methoxy-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 94143951 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-bromo-4-ethoxy-5-methoxy-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(Br)c(OCC)c(OC)c1 |
| InChI | InChI=1S/C16H20BrNO3/c1-5-8-18(9-6-2)16(19)12-10-13(17)15(21-7-3)14(11-12)20-4/h5-6,10-11H,1-2,7-9H2,3-4H3 |
| InChIKey | PDSXLLKWLOYLBE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|