C16H19BrN2O6 — CID 18777292
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-bromo-4-ethoxy-5-methoxybenzoate (PubChem CID 18777292) has the molecular formula C16H19BrN2O6 and a molecular weight of 415.24 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-bromo-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 18777292 |
| Molecular Formula | C16H19BrN2O6 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1cc(Br)c(OCC)c(OC)c1 |
| InChI | InChI=1S/C16H19BrN2O6/c1-4-6-18-16(22)19-13(20)9-25-15(21)10-7-11(17)14(24-5-2)12(8-10)23-3/h4,7-8H,1,5-6,9H2,2-3H3,(H2,18,19,20,22) |
| InChIKey | YTAVAKZSENRISF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|