C17H18BrNO6 — CID 7456674
[2-(furan-2-ylmethylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate (PubChem CID 7456674) has the molecular formula C17H18BrNO6 and a molecular weight of 412.24 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7456674 |
| Molecular Formula | C17H18BrNO6 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 3-bromo-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Br)cc(C(=O)OCC(=O)NCc2ccco2)cc1OC |
| InChI | InChI=1S/C17H18BrNO6/c1-3-23-16-13(18)7-11(8-14(16)22-2)17(21)25-10-15(20)19-9-12-5-4-6-24-12/h4-8H,3,9-10H2,1-2H3,(H,19,20) |
| InChIKey | FJDZCDNEWBGBLI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |