C17H20BrNO4 — CID 51204584
2-(2-bromo-4,5-diethoxyphenyl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 51204584) has the molecular formula C17H20BrNO4 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51204584 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCOc1cc(Br)c(CC(=O)NCc2ccco2)cc1OCC |
| InChI | InChI=1S/C17H20BrNO4/c1-3-21-15-8-12(14(18)10-16(15)22-4-2)9-17(20)19-11-13-6-5-7-23-13/h5-8,10H,3-4,9,11H2,1-2H3,(H,19,20) |
| InChIKey | FITXNSFIQPBWOF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |