C19H21BrN2O5 — CID 55798813
2-(2-bromo-4,5-diethoxyphenyl)-N-[(2-nitrophenyl)methyl]acetamide (PubChem CID 55798813) has the molecular formula C19H21BrN2O5 and a molecular weight of 437.29 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-N-[(2-nitrophenyl)methyl]acetamide.
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-[(2-nitrophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55798813 |
| Molecular Formula | C19H21BrN2O5 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-[(2-nitrophenyl)methyl]acetamide |
| SMILES | CCOc1cc(Br)c(CC(=O)NCc2ccccc2[N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C19H21BrN2O5/c1-3-26-17-9-14(15(20)11-18(17)27-4-2)10-19(23)21-12-13-7-5-6-8-16(13)22(24)25/h5-9,11H,3-4,10,12H2,1-2H3,(H,21,23) |
| InChIKey | ZTKASLQGURCWHO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|