C20H24BrNO4 — CID 32933896
2-(2-bromo-4,5-diethoxyphenyl)-N-(2-phenoxyethyl)acetamide (PubChem CID 32933896) has the molecular formula C20H24BrNO4 and a molecular weight of 422.32 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 32933896 |
| Molecular Formula | C20H24BrNO4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-(2-phenoxyethyl)acetamide |
| SMILES | CCOc1cc(Br)c(CC(=O)NCCOc2ccccc2)cc1OCC |
| InChI | InChI=1S/C20H24BrNO4/c1-3-24-18-12-15(17(21)14-19(18)25-4-2)13-20(23)22-10-11-26-16-8-6-5-7-9-16/h5-9,12,14H,3-4,10-11,13H2,1-2H3,(H,22,23) |
| InChIKey | XFDNKRJLYSYXDI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|