C20H23BrN2O5 — CID 75416268
2-(pyridine-4-carbonylamino)ethyl 2-(2-bromo-4,5-diethoxyphenyl)acetate (PubChem CID 75416268) has the molecular formula C20H23BrN2O5 and a molecular weight of 451.32 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)ethyl 2-(2-bromo-4,5-diethoxyphenyl)acetate.
| Compound Name | 2-(pyridine-4-carbonylamino)ethyl 2-(2-bromo-4,5-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 75416268 |
| Molecular Formula | C20H23BrN2O5 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)ethyl 2-(2-bromo-4,5-diethoxyphenyl)acetate |
| SMILES | CCOc1cc(Br)c(CC(=O)OCCNC(=O)c2ccncc2)cc1OCC |
| InChI | InChI=1S/C20H23BrN2O5/c1-3-26-17-11-15(16(21)13-18(17)27-4-2)12-19(24)28-10-9-23-20(25)14-5-7-22-8-6-14/h5-8,11,13H,3-4,9-10,12H2,1-2H3,(H,23,25) |
| InChIKey | RNZBRQIHYKYXLT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|