C16H16BrNO4 — CID 22938241
methyl 2-[2-bromo-5-methoxy-4-(pyridin-4-ylmethoxy)phenyl]acetate (PubChem CID 22938241) has the molecular formula C16H16BrNO4 and a molecular weight of 366.21 g/mol. Its IUPAC name is methyl 2-[2-bromo-5-methoxy-4-(pyridin-4-ylmethoxy)phenyl]acetate.
| Compound Name | methyl 2-[2-bromo-5-methoxy-4-(pyridin-4-ylmethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 22938241 |
| Molecular Formula | C16H16BrNO4 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | methyl 2-[2-bromo-5-methoxy-4-(pyridin-4-ylmethoxy)phenyl]acetate |
| SMILES | COC(=O)Cc1cc(OC)c(OCc2ccncc2)cc1Br |
| InChI | InChI=1S/C16H16BrNO4/c1-20-14-7-12(8-16(19)21-2)13(17)9-15(14)22-10-11-3-5-18-6-4-11/h3-7,9H,8,10H2,1-2H3 |
| InChIKey | IZSAWCXPPLLSFR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |