C16H21BrO4 — CID 55476277
2-methylprop-2-enyl 2-(2-bromo-4,5-diethoxyphenyl)acetate (PubChem CID 55476277) has the molecular formula C16H21BrO4 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-(2-bromo-4,5-diethoxyphenyl)acetate.
| Compound Name | 2-methylprop-2-enyl 2-(2-bromo-4,5-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 55476277 |
| Molecular Formula | C16H21BrO4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-methylprop-2-enyl 2-(2-bromo-4,5-diethoxyphenyl)acetate |
| SMILES | C=C(C)COC(=O)Cc1cc(OCC)c(OCC)cc1Br |
| InChI | InChI=1S/C16H21BrO4/c1-5-19-14-7-12(8-16(18)21-10-11(3)4)13(17)9-15(14)20-6-2/h7,9H,3,5-6,8,10H2,1-2,4H3 |
| InChIKey | NNSGVAAGZVAJSW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|