C14H19BrO4 — CID 43330604
4-(2-bromo-4,5-diethoxyphenyl)butanoic acid (PubChem CID 43330604) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-(2-bromo-4,5-diethoxyphenyl)butanoic acid.
| Compound Name | 4-(2-bromo-4,5-diethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 43330604 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-(2-bromo-4,5-diethoxyphenyl)butanoic acid |
| SMILES | CCOc1cc(Br)c(CCCC(=O)O)cc1OCC |
| InChI | InChI=1S/C14H19BrO4/c1-3-18-12-8-10(6-5-7-14(16)17)11(15)9-13(12)19-4-2/h8-9H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | ULQRGVZCADVMFU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |