C13H17BrO5 — CID 45371599
ethyl 2-[5-bromo-2-ethoxy-4-(hydroxymethyl)phenoxy]acetate (PubChem CID 45371599) has the molecular formula C13H17BrO5 and a molecular weight of 333.18 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-ethoxy-4-(hydroxymethyl)phenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-2-ethoxy-4-(hydroxymethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 45371599 |
| Molecular Formula | C13H17BrO5 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | ethyl 2-[5-bromo-2-ethoxy-4-(hydroxymethyl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(CO)cc1OCC |
| InChI | InChI=1S/C13H17BrO5/c1-3-17-11-5-9(7-15)10(14)6-12(11)19-8-13(16)18-4-2/h5-6,15H,3-4,7-8H2,1-2H3 |
| InChIKey | RVPPULFIUFGCAN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |