C20H20BrNO4 — CID 8536200
(4-cyanophenyl)methyl 2-(2-bromo-4,5-diethoxyphenyl)acetate (PubChem CID 8536200) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(2-bromo-4,5-diethoxyphenyl)acetate.
| Compound Name | (4-cyanophenyl)methyl 2-(2-bromo-4,5-diethoxyphenyl)acetate |
|---|---|
| PubChem CID | 8536200 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(2-bromo-4,5-diethoxyphenyl)acetate |
| SMILES | CCOc1cc(Br)c(CC(=O)OCc2ccc(C#N)cc2)cc1OCC |
| InChI | InChI=1S/C20H20BrNO4/c1-3-24-18-9-16(17(21)11-19(18)25-4-2)10-20(23)26-13-15-7-5-14(12-22)6-8-15/h5-9,11H,3-4,10,13H2,1-2H3 |
| InChIKey | KLEVHXITYJZCRX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |