C18H16BrNO5 — CID 9140937
(4-bromo-2,5-dimethoxyphenyl)methyl 2-(4-cyanophenoxy)acetate (PubChem CID 9140937) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)methyl 2-(4-cyanophenoxy)acetate.
| Compound Name | (4-bromo-2,5-dimethoxyphenyl)methyl 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9140937 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (4-bromo-2,5-dimethoxyphenyl)methyl 2-(4-cyanophenoxy)acetate |
| SMILES | COc1cc(COC(=O)COc2ccc(C#N)cc2)c(OC)cc1Br |
| InChI | InChI=1S/C18H16BrNO5/c1-22-16-8-15(19)17(23-2)7-13(16)10-25-18(21)11-24-14-5-3-12(9-20)4-6-14/h3-8H,10-11H2,1-2H3 |
| InChIKey | XXVCGPJMCPQRNW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |