(4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate

C18H16BrNO5 — CID 9275038

IUPAC(4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate
SMILESCOc1cc(COC(=O)COc2ccccc2C#N)c(OC)cc1Br
InChIInChI=1S/C18H16BrNO5/c1-22-16-8-14(19)17(23-2)7-13(16)10-25-18(21)11-24-15-6-4-3-5-12(15)9-20/h3-8H,10-11H2,1-2H3
InChIKeySGMHHIHWCARHFL-UHFFFAOYSA-N
MW406.23 g/mol
LogP3.46
Rot. Bonds7

About (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate

(4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate (PubChem CID 9275038) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate.

Molecular Properties

Compound Name(4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate
PubChem CID9275038
Molecular FormulaC18H16BrNO5
Molecular Weight406.23 g/mol
Exact Mass405.02
IUPAC Name(4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate
SMILESCOc1cc(COC(=O)COc2ccccc2C#N)c(OC)cc1Br
InChIInChI=1S/C18H16BrNO5/c1-22-16-8-14(19)17(23-2)7-13(16)10-25-18(21)11-24-15-6-4-3-5-12(15)9-20/h3-8H,10-11H2,1-2H3
InChIKeySGMHHIHWCARHFL-UHFFFAOYSA-N
XLogP3.46
TPSA77.78 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500406.23
LogP ≤ 53.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate?
The IUPAC name of (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate (CID 9275038) is (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate.
What is the SMILES notation for (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate?
The canonical SMILES for (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate is COc1cc(COC(=O)COc2ccccc2C#N)c(OC)cc1Br.
What is the InChIKey of (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate?
The InChIKey is SGMHHIHWCARHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrNO5/c1-22-16-8-14(19)17(23-2)7-13(16)10-25-18(21)11-24-15-6-4-3-5-12(15)9-20/h3-8H,10-11H2,1-2H3.
What are the key properties of (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate?
(4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate has a molecular weight of 406.23 g/mol, XLogP of 3.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,5-dimethoxyphenyl)methyl 2-(2-cyanophenoxy)acetate is sourced from PubChem (CID 9275038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).