C18H18BrNO4 — CID 18143067
4-[(4-bromo-2,5-dimethoxyphenyl)methoxy]-3-ethoxybenzonitrile (PubChem CID 18143067) has the molecular formula C18H18BrNO4 and a molecular weight of 392.25 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-dimethoxyphenyl)methoxy]-3-ethoxybenzonitrile.
| Compound Name | 4-[(4-bromo-2,5-dimethoxyphenyl)methoxy]-3-ethoxybenzonitrile |
|---|---|
| PubChem CID | 18143067 |
| Molecular Formula | C18H18BrNO4 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 4-[(4-bromo-2,5-dimethoxyphenyl)methoxy]-3-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCc1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C18H18BrNO4/c1-4-23-18-7-12(10-20)5-6-15(18)24-11-13-8-17(22-3)14(19)9-16(13)21-2/h5-9H,4,11H2,1-3H3 |
| InChIKey | WIUCYXNTLLCGEB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |