C17H16BrNO6S — CID 55386916
(4-cyano-2-ethoxyphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate (PubChem CID 55386916) has the molecular formula C17H16BrNO6S and a molecular weight of 442.29 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate.
| Compound Name | (4-cyano-2-ethoxyphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 55386916 |
| Molecular Formula | C17H16BrNO6S |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 2-bromo-4,5-dimethoxybenzenesulfonate |
| SMILES | CCOc1cc(C#N)ccc1OS(=O)(=O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C17H16BrNO6S/c1-4-24-16-7-11(10-19)5-6-13(16)25-26(20,21)17-9-15(23-3)14(22-2)8-12(17)18/h5-9H,4H2,1-3H3 |
| InChIKey | GUEAWULFYMPTPL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|