C19H20BrNO6S — CID 31013678
(2-bromo-4-cyano-6-ethoxyphenyl) 3,4-diethoxybenzenesulfonate (PubChem CID 31013678) has the molecular formula C19H20BrNO6S and a molecular weight of 470.34 g/mol. Its IUPAC name is (2-bromo-4-cyano-6-ethoxyphenyl) 3,4-diethoxybenzenesulfonate.
| Compound Name | (2-bromo-4-cyano-6-ethoxyphenyl) 3,4-diethoxybenzenesulfonate |
|---|---|
| PubChem CID | 31013678 |
| Molecular Formula | C19H20BrNO6S |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | (2-bromo-4-cyano-6-ethoxyphenyl) 3,4-diethoxybenzenesulfonate |
| SMILES | CCOc1ccc(S(=O)(=O)Oc2c(Br)cc(C#N)cc2OCC)cc1OCC |
| InChI | InChI=1S/C19H20BrNO6S/c1-4-24-16-8-7-14(11-17(16)25-5-2)28(22,23)27-19-15(20)9-13(12-21)10-18(19)26-6-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | JPXCOMVNUUDCDQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|