C19H20BrNO3 — CID 20988977
3-bromo-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxybenzonitrile (PubChem CID 20988977) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is 3-bromo-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxybenzonitrile.
| Compound Name | 3-bromo-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxybenzonitrile |
|---|---|
| PubChem CID | 20988977 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 3-bromo-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)cc(Br)c1OCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C19H20BrNO3/c1-4-22-18-11-15(12-21)10-16(20)19(18)24-8-7-23-17-9-13(2)5-6-14(17)3/h5-6,9-11H,4,7-8H2,1-3H3 |
| InChIKey | ODGKXZLDRVVKTE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|